![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|---|
|
|---|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[ ]](/icons/layout.gif) | 1 Medical Mycology manual PGIMER.pdf | 2022-12-04 05:27 | 2.2M | |
| An_Introduction_to_Epidemiology_for_Health_Professionals.pdf | 2022-12-04 05:27 | 1.6M | |
| Applied-Bioinformatics-1598044196._print.pdf | 2021-02-12 02:06 | 7.7M | |
| Basic tools for quality improvement in health care informatics.pdf | 2021-02-10 06:12 | 11M | |
| Bioinformatics of genome evolution from ancestral to modern metabolism Phylogenomics and comparative genomics to understand microbial evolution.pdf | 2023-01-07 18:52 | 1.4M | |
| Cancer systems biology bioinformatics and medicine.[ Cesario, Alfredo].pdf | 2022-12-04 05:27 | 15M | |
| Chemical-Biology-amp-Biochemistry-Laboratory-Using-Genetic-Code-Expansion-Manual-1609909461._print.pdf | 2021-02-12 02:04 | 3.0M | |
| Chemical Pathology MBChB student lecture notes.pdf | 2022-12-04 05:27 | 6.1M | |
| Clinical Laboratory Investigation2.pdf | 2022-12-04 05:27 | 4.6M | |
| Clinical Mycology - Dismukes, William E.; Pappas, _1359.pdf | 2022-12-04 05:27 | 3.6M | |
| Clinician's Pocket drug reference 2008. [ Gomella, Leonard G.].pdf.pdf | 2022-12-04 05:27 | 2.8M | |
| Clinician's pocket drug reference 2009. [Gomella, Leonard. G.].pdf | 2022-12-04 05:27 | 2.2M | |
| Communicable Diseases.pdf | 2022-12-04 05:27 | 621K | |
| Communicable_Diseases_Part_4.lo.pdf | 2022-12-04 05:27 | 2.0M | |
| Diseases and Disorders Chronic Fatique Syndrome .[Abrams ,Liesa].pdf.pdf | 2022-12-04 05:27 | 4.9M | |
| ENVIRONMENTAL HEALTH AND DISEASE.pdf | 2022-12-04 05:27 | 738K | |
| EPIDEMIOLOGY FOR COMMUNITY HEALTH.pdf | 2022-12-04 05:27 | 862K | |
| Ebola (Deadly Diseases and Epidemics) ( PDFDrive ).pdf | 2022-12-04 05:27 | 2.8M | |
| Ebola Virus Haemorragic Fever-SPattyn.pdf | 2022-12-04 05:27 | 5.5M | |
| Ebola virus disease _ from origin to outbreak ( PDFDrive ).pdf | 2022-12-04 05:27 | 9.9M | |
| Emerging Infectious Diseases ( etc.) (z-lib.org).pdf | 2022-07-22 10:39 | 62M | |
![[ ]](/icons/unknown.gif) | Encyclopedia of Molecular Pharmacology (Vol 1 & 2) 2nd Edition.Pdf | 2022-12-04 05:27 | 32M | |
| Gastrointestinal Nursing.pdf | 2022-12-04 05:27 | 4.3M | |
| General-Microbiology-1636412705._print.pdf | 2022-12-21 17:44 | 17M | |
| General pathology.pdf | 2022-12-04 05:27 | 897K | |
| Harrisons-infectious-diseases.pdf | 2022-12-04 05:27 | 38M | |
| Human PARASITOLOGY in tropical setting.pdf | 2022-12-04 05:27 | 6.0M | |
| INTRODUCTION TO BIOSTATISTICS.pdf | 2022-12-04 05:27 | 496K | |
| Immunology Fifth Edition.pdf | 2022-12-04 05:27 | 22M | |
| Immunology and Immunization (1).pdf | 2022-12-04 05:27 | 1.0M | |
| Immunology and serology book.pdf | 2022-12-04 05:27 | 427K | |
| Integrating neglected tropical diseases into global health and development.pdf | 2021-03-25 14:42 | 7.3M | |
| Introduction to HIV AIDS.pdf | 2022-12-04 05:27 | 2.6M | |
| Intro to HIVAIDS.pdf | 2022-12-04 05:27 | 2.6M | |
| Intro to Organic Chemistry.pdf | 2022-12-04 05:27 | 2.6M | |
| LN_Immunohaematology_final.pdf | 2022-12-04 05:27 | 650K | |
| Laboratory safety handbook.pdf | 2023-01-06 09:47 | 4.9M | |
| Lung Biology in Health Disease(BookFi)[Oomen, P. Mathew].pdf | 2022-12-04 05:27 | 3.9M | |
| Mcqs in microbiology.pdf | 2022-12-04 05:27 | 433K | |
| Medical Microbiology_The Big Picture(BookZZ.org) - Copy.pdf | 2022-12-04 05:27 | 12M | |
| Microbiology-A-Laboratory-Experience-1530561883-1 (1).pdf | 2021-03-11 23:58 | 4.0M | |
| Microbiology- A Photographic Atlas CLINICAL PLACEMENT RMH - Copy.pdf | 2022-12-04 05:27 | 17M | |
| Microbiology Coloring Book_Microbiology.pdf | 2022-12-04 05:27 | 119K | |
| Modern Infectious Disease Epidemiology Concepts, Methods, Mathematical Models, and Public Health (Paulo Pinheiro, Colin D. Mathers etc.) (z-lib.org).pdf | 2022-07-22 10:34 | 10M | |
| Molecular Basis of Pulmonary Desease, Insights from RARE lung Disorders.[Mc Cormarck, Francis.x.]pdf.pdf | 2022-12-04 05:27 | 18M | |
| Monica-Cheesbrough-District-Laboratory-Practice-in-Tropical-Countries-Part-1.pdf | 2022-12-04 05:27 | 6.5M | |
| Oncology nursing management in cancer care.pdf | 2022-12-04 05:27 | 663K | |
| PARASITOLOGY IN TROPICAL SETTING - Copy.pdf | 2020-12-05 08:48 | 5.9M | |
| Pocket Guide to Musculoskeletal Diagnosis.[Cooper, Grant.]pdf.pdf | 2022-12-04 05:27 | 3.3M | |
| Polyploidization and cancer advances in experiment Volume 668.pdf | 2022-12-04 05:27 | 3.4M | |
| Tuberculosis in Adults and Children by Dorothee, Heemskerk..pdf | 2021-05-19 09:03 | 1.8M | |
| [Drew Provan]_ ABC of Clinical Haematology, 3rd edi(BookFi).pdf | 2022-12-04 05:27 | 2.7M | |
|
|---|