![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|---|
|
|---|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[ ]](/icons/layout.gif) | H104_ BRS_physiology-5th-ed-2011.pdf | 2022-12-04 05:27 | 25M | |
| H132_Community Health_1 Medical Mycology manual PGIMER.pdf | 2022-12-04 05:27 | 2.2M | |
| H132_Community Health_Diagnosis of Fungal Infections (Informa, 2007).pdf | 2022-12-04 05:27 | 9.4M | |
| H132_Community Health_Mandell, Douglas, and Bennett's Principles and Practice of Infectious Diseases, 8E (2015) [PDF] [UnitedVRG].pdf | 2022-12-04 05:27 | 469M | |
| H181, H232, H281_Review of medical microbiology&Immunology.pdf | 2022-12-04 05:27 | 88M | |
| H181,H232,H332_Clinical Microbiology I,II,III_Alcamo's_Fundamentals_of_Microbiology(BookZZ.org).pdf | 2022-12-04 05:27 | 109M | |
| H181,H232,H332_Clinical Microbiology I,II,III_Bailey Scott Diagnostic Microbiology.pdf | 2022-12-04 05:27 | 17M | |
| H181,H232,H332_Clinical Microbiology I,II,III_Bergey's.Manual.of.Systematic.Bacteriology.2nd.ed.Vol.2.Part.A.2005.Springer.3HAXAP.pdf | 2022-12-04 05:27 | 18M | |
| H181,H232,H332_Clinical Microbiology I,II,III_Bergey's.Manual.of.Systematic.Bacteriology.2nd.ed.Vol.2.Part.C.2005.Springer.3HAXAP.pdf | 2022-12-04 05:27 | 79M | |
| H181,H232,H332_Clinical Microbiology I,II,III_Medical Microbiology, Seventh Edition- Murray, Rosenthal, Pfaller.pdf | 2022-12-04 05:27 | 74M | |
| H181,H232,H332_Clinical Microbiology I,II,III_Medical_Microbiology_The_Big_Picture(BookZZ.org) - Copy.pdf | 2022-12-04 05:27 | 12M | |
| H181,H232,H332_Clinical Microbiology I,II,III_Microbiology- A Photographic Atlas - Copy.pdf | 2022-12-04 05:27 | 17M | |
| H181,H232,H332_Clinical Microbiology I,II,III_Microbiology - An Introduction 11th Edition.pdf | 2022-12-04 05:27 | 58M | |
| H181,H232,H332_Clinical Microbiology I,II,III_Microbiology_Microbiology_and_bactiology_1.pdf | 2022-12-04 05:27 | 7.7M | |
| H181,H232,H332_Clinical Microbiology I,II,III_Microbiology_Prescott Harley Kleins Microbiology 7th Edition - {Nosnibor} [ebook pdf].pdf | 2022-12-04 05:27 | 59M | |
| H181,H232,H332_Clinical Microbiology I,II,III_color-atlas-of-diagnostic-microbiology.pdf | 2022-12-04 05:27 | 43M | |
| H182,H233_Parasitology and Entomology[Stephen_H._Gillespie_(Editor)__Richard_D._Pearson(BookFi) parasitology.pdf | 2022-12-04 05:27 | 12M | |
| H182,H233_Parasitology and Entomology_parasitology_.pdf | 2022-12-04 05:27 | 809K | |
| H182,H233_Parasitology and Entomology_parasitology_book.pdf | 2022-12-04 05:27 | 793K | |
| H183 & H335-biochemistry-molecular-biology-and-genetics-6e-2013-pdf-unitedvrg.pdf | 2022-12-04 05:27 | 50M | |
| H183_Biochemistry and Genetics_[Golder_Wilson]_Biochemistry_and_Genetics(BookFi).pdf | 2022-12-04 05:27 | 2.3M | |
| H183_Biochemistry and Genetics_[Wilson_G.N.,_Schroeder_B.,_Woo_J.]_Biochemistry_a(BookFi).pdf | 2022-12-04 05:27 | 3.1M | |
| H185,H235, H334,H532_Clinical Chemistry I,II,III,IV_[Herbert_E._Spiegel]_Advances_in_Clinical_Chemistr(BookFi).pdf | 2022-12-04 05:27 | 14M | |
| H185,H235, H334,H532_Clinical Chemistry I,II,III,IV_[Oscar_Bodansky,_Corbet_P._Stewart]_Advances_in_Cl(BookFi).pdf | 2022-12-04 05:27 | 25M | |
| H185,H235, H334,H532_Clinical Chemistry I,II,III,IV_[WendyLArnesonJeanBrickel]_Clinical_Chemistry_A_L(BookFi).pdf | 2022-12-04 05:27 | 17M | |
| H185,H235, H334,H532_Clinical Chemistry I,II,III,IV_tietz.pdf | 2022-12-04 05:27 | 117M | |
| H231,H333,H533_Clinical Heamatology and Blood transfusion I,II,III_[Drew_Provan,_Charles_R._J._Singer,_Trevor_Baglin,(BookFi) heamatology.pdf | 2022-12-04 05:27 | 6.4M | |
| H231,H333,H533_Clinical Heamatology and Blood transfusion I,II,III_[Drew_Provan]_ABC_of_Clinical_Haematology,_3rd_Edi(BookFi).pdf | 2022-12-04 05:27 | 2.7M | |
| H234, H433_Histology &histopathology[Paul.J_Tadrous]_Diagnostic_Criteria_Handbook_in_H(BookFi)(1).pdf | 2022-12-04 05:27 | 18M | |
| H234, H433_Histology &histopathology_[Kurt_E._Johnson]_Histology_and_Cell_Biology(BookFi).pdf | 2022-12-04 05:27 | 51M | |
| H281, H432_Virology&Immunology_Kuby_Immunology.pdf | 2022-12-04 05:27 | 22M | |
| H335_Pierce B. A. (2012). Genetics A conceptual approach. Macmillan. (1).pdf | 2022-12-04 05:27 | 23M | |
| H431_Hu, P., Hegde, M., & Lennon, P. A. (Eds.). (2012). Modern clinical molecular techniques. Springer Science & Business Media..pdf | 2022-12-04 05:27 | 5.3M | |
| H431_Persing, D. H., Tenover, F. C., Tang, Y. W., Nolte, F. S., Hayden, R. T., & Belkum, A. V. (2011). Molecular microbiology diagnostic principles and practice (No. Ed. 2). ASM press..pdf | 2022-12-04 05:27 | 25M | |
| H431_Wilson, K., & Walker, J. (Eds.). (2010). Principles and techniques of biochemistry and molecular biology. Cambridge university press..pdf | 2022-12-04 05:27 | 8.7M | |
| H531_Bionformatics-books.pdf | 2022-12-04 05:27 | 3.5M | |
| H531_Essential Bioinformatics.pdf | 2022-12-04 05:27 | 15M | |
| H531_Primrose, S. B., & Twyman, R. (2009). Principles of genome analysis and genomics. John Wiley & Sons..pdf | 2022-12-04 05:27 | 4.3M | |
|
|---|