![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[ ]](/icons/layout.gif) | A-Short-History-of-England-Ireland-and-Scotland.pdf | 2021-04-14 15:56 | 1.3M | |
![[ ]](/icons/layout.gif) | A-history-of-China-3d-ed-rev-and-enl.pdf | 2021-04-14 15:06 | 4.4M | |
![[ ]](/icons/layout.gif) | A Critical History of Early Rome by Gary, Forsythe(BookFi).pdf | 2022-12-04 05:27 | 2.4M | |
![[ ]](/icons/layout.gif) | A History of West Africa 1000-1800 ( PDFDrive.com ).pdf | 2019-01-30 11:13 | 50M | |
![[ ]](/icons/layout.gif) | A Lecture on The Armenian Genocide.pdf.pdf | 2022-12-04 05:27 | 47K | |
![[ ]](/icons/layout.gif) | Accounting-for-horror-post-genocide-debates-in-rwa.pdf | 2022-12-04 05:27 | 1.0M | |
![[ ]](/icons/layout.gif) | Africa-an-encyclopedia-for-students-edition-1.pdf | 2022-12-04 05:27 | 7.6M | |
![[ ]](/icons/layout.gif) | African Traditional - Aloysius M. Lugira.pdf | 2022-12-04 05:27 | 5.0M | |
![[ ]](/icons/layout.gif) | Africa since 1800 by Roland, Oliver(BookLid.org).pdf | 2022-12-04 05:27 | 4.4M | |
![[ ]](/icons/layout.gif) | A map of Africa.pdf.pdf | 2022-12-04 05:27 | 1.3M | |
![[ ]](/icons/layout.gif) | American growth and Napoleonic wars by Hassan, V.pdf | 2022-12-04 05:27 | 383K | |
![[ ]](/icons/layout.gif) | An -encyclopedia-for-students-sadat-zulu-amp.pdf | 2022-12-04 05:27 | 8.1M | |
![[ ]](/icons/layout.gif) | An Outline History of East Asia to 1200 by Sarah, Schneewin..pdf | 2021-05-10 16:31 | 14M | |
![[ ]](/icons/layout.gif) | Ancient Europe,8000 by Crabtree, Pam(BookLid.org).pdf | 2018-11-03 09:55 | 19M | |
![[ ]](/icons/layout.gif) | Antecedents to Modern Rwanda by Vansina, Jan(BookFi).pdf | 2022-12-04 05:27 | 1.5M | |
![[ ]](/icons/layout.gif) | Armenian Genocide Facts and Figures Revised.pdf | 2022-12-04 05:27 | 1.6M | |
![[ ]](/icons/layout.gif) | Armenian Genocide chapter 6 (1).pdf | 2022-12-04 05:27 | 1.3M | |
![[ ]](/icons/layout.gif) | Armenian genocide.pdf | 2022-12-04 05:27 | 9.5M | |
![[ ]](/icons/layout.gif) | Art of War - by Sun Tzu.pdf | 2022-12-04 05:27 | 524K | |
![[ ]](/icons/layout.gif) | A short history of the United States by Robert, V.pdf | 2022-12-04 05:27 | 4.1M | |
![[ ]](/icons/layout.gif) | As we forgive stories of reconciliation from rwanda.pdf | 2022-12-04 05:27 | 2.8M | |
![[ ]](/icons/layout.gif) | Becoming America_ An Exploration of American Literature from Prec.pdf | 2021-02-09 07:56 | 32M | |
![[ ]](/icons/layout.gif) | Cambodian Genocide World Without Genocide.pdf | 2022-12-04 05:27 | 284K | |
![[ ]](/icons/layout.gif) | Cambodian genocide byKiernan, Ben.pdf | 2022-12-04 05:27 | 5.8M | |
![[ ]](/icons/layout.gif) | Case Study First Modern Genocide 20th Century 4th Ed- Overheads - Section 4.pdf | 2014-10-10 15:23 | 1.0M | |
![[ ]](/icons/layout.gif) | Century of genocide by Totten, Samuel.pdf | 2022-12-04 05:27 | 7.2M | |
![[ ]](/icons/layout.gif) | Chaldea-From-the-Earliest-Times-to-the-Rise-of-Assyria.pdf | 2021-04-14 14:48 | 10M | |
![[ ]](/icons/layout.gif) | China's-history.pdf | 2022-12-04 05:27 | 12M | |
![[ ]](/icons/layout.gif) | China's republic new approaches to asian history.pdf.pdf | 2022-12-04 05:27 | 3.9M | |
![[ ]](/icons/layout.gif) | China, A newhistory.pdf.pdf | 2022-12-04 05:27 | 2.8M | |
![[ ]](/icons/layout.gif) | China.pdf | 2021-04-14 15:19 | 1.4M | |
![[ ]](/icons/layout.gif) | Chronicles-1-of-6-The-Historie-of-England-7-of-8-The-Seventh-Boke-of-the-Historie-of-England.pdf | 2021-04-14 15:16 | 380K | |
![[ ]](/icons/layout.gif) | Chronicles-of-England-Scotland-and-Ireland-2-of-6-England-3-of-12-Henrie-I.pdf | 2021-04-14 15:19 | 347K | |
![[ ]](/icons/layout.gif) | Culture and Customs of Rwanda by Adekunle, Julius O. (BookFi).pdf | 2022-12-04 05:27 | 2.1M | |
![[ ]](/icons/layout.gif) | Culture and customs of Rwanda.pdf | 2022-12-04 05:27 | 2.1M | |
![[ ]](/icons/layout.gif) | Defeat is the only bad news David Newbury(BookFi).pdf | 2022-12-04 05:27 | 1.6M | |
![[ ]](/icons/layout.gif) | Defeat is the only bad news Rwanda under Musinga 1896-1931.pdf | 2022-12-04 05:27 | 1.6M | |
![[ ]](/icons/layout.gif) | Diagraming the Main Points and Components of the French Revolution.pdf | 2022-12-04 05:27 | 7.4M | |
![[ ]](/icons/layout.gif) | Eastern Europe An Introduction to people, land, culture by Frucht, Richard(BookLid.org).pdf | 2022-12-04 05:27 | 13M | |
![[ ]](/icons/layout.gif) | Education in Rwanda Rebalancing Reso(BookFi).pdf | 2022-12-04 05:27 | 4.5M | |
![[ ]](/icons/layout.gif) | Empires of medieval west africa by David, c. conrad.pdf | 2022-12-04 05:27 | 7.3M | |
![[ ]](/icons/layout.gif) | England-in-America-1580-1652.pdf | 2021-04-14 15:56 | 1.9M | |
![[ ]](/icons/layout.gif) | England-under-the-Tudors.pdf | 2021-04-14 15:55 | 1.5M | |
![[ ]](/icons/layout.gif) | Europe-After-8-15.pdf | 2021-04-14 15:55 | 1.4M | |
![[ ]](/icons/layout.gif) | Evolution-Of-The-Japanese-Social-And-Psychic.pdf | 2021-04-14 15:55 | 1.7M | |
![[ ]](/icons/layout.gif) | Exploration of Africa the emerging nations, West Africa 188o to present.pdf | 2022-12-04 05:27 | 4.3M | |
![[ ]](/icons/layout.gif) | Face-to-Face-with-Kaiserism.pdf | 2021-04-14 15:35 | 1.9M | |
![[ ]](/icons/layout.gif) | Final Solutions-Mass Killing and Genocide in the 20th Century.pdf | 2022-12-04 05:27 | 873K | |
![[ ]](/icons/layout.gif) | French-napoleonic-artillery.pdf | 2022-12-04 05:27 | 6.3M | |
![[ ]](/icons/layout.gif) | French colonialism, Unmasked.pdf | 2022-12-04 05:27 | 1.5M | |
![[ ]](/icons/layout.gif) | Frontier-Encounters-v1.1.pdf | 2021-05-10 09:55 | 14M | |
![[ ]](/icons/layout.gif) | General History of Africa,A. Adu Boahen Volume BookFi.pdf | 2018-02-02 09:11 | 60M | |
![[ ]](/icons/layout.gif) | General History of Africa,Bethwell A. Ogot Vol BookFi.pdf | 2018-02-02 01:56 | 70M | |
![[ ]](/icons/layout.gif) | General History of Africa, Djibril Tamsir Niane BookFi.pdf | 2018-02-02 01:19 | 45M | |
![[ ]](/icons/layout.gif) | General History of Africa, Volume. J.F. Ade Ajayi.pdf | 2018-02-02 01:42 | 55M | |
![[ ]](/icons/layout.gif) | General History of Africa, Volume 2.pdf | 2018-01-27 05:01 | 46M | |
![[ ]](/icons/layout.gif) | General History of Africa,[G. Mokhtar Editor.pdf | 2018-01-27 05:01 | 46M | |
![[ ]](/icons/layout.gif) | General History of Africa Joseph Ki-Zerb oEditor.pdf | 2018-02-02 01:43 | 48M | |
![[ ]](/icons/layout.gif) | General History of Africa M.El Fasi Editor.pdf | 2018-02-02 01:40 | 50M | |
![[ ]](/icons/layout.gif) | Genocide. A Comprehensive Introduction 2nd Edition by Adam Jones [2011].pdf | 2014-09-29 21:24 | 11M | |
![[ ]](/icons/layout.gif) | Genocide in cambodia and east timor by Christopher, anderson.pdf | 2022-12-04 05:27 | 516K | |
![[ ]](/icons/layout.gif) | Great-Britain-and-the-American-Civil-War.pdf | 2021-04-14 15:35 | 3.9M | |
![[ ]](/icons/layout.gif) | Greece-and-the-Allies-1914-1922.pdf | 2021-04-14 15:55 | 832K | |
![[ ]](/icons/layout.gif) | Greek and Latin Roots Part I - Latin.pdf | 2022-12-04 05:27 | 2.5M | |
![[ ]](/icons/layout.gif) | Greek and Latin Roots_ Part II Greek.pdf | 2022-12-04 05:27 | 1.2M | |
![[ ]](/icons/layout.gif) | Henry-IV-Makers-of-History.pdf | 2021-04-14 15:55 | 1.7M | |
![[ ]](/icons/layout.gif) | Historic-China-and-other-sketches.pdf | 2021-04-14 15:55 | 728K | |
![[ ]](/icons/layout.gif) | History-Manners-and-Customs-of-the-North-American-Indians.pdf | 2021-04-14 15:54 | 2.8M | |
![[ ]](/icons/layout.gif) | History-of-Australia-and-New-Zealand-From-1606-to-1890.pdf | 2021-04-14 15:35 | 4.9M | |
![[ ]](/icons/layout.gif) | History-of-Egypt-Chaldea-Syria-Babylonia-and-Assyria-in-the-Light-of-Recent-Discovery.pdf | 2021-04-14 14:51 | 14M | |
![[ ]](/icons/layout.gif) | History-of-Egypt-From-330-B-C-To-the-Present-Time-Volume-12-of-12.pdf | 2021-04-14 15:18 | 14M | |
![[ ]](/icons/layout.gif) | History-of-Friedrich-II-of-Prussia-Volume-12.pdf | 2021-04-14 15:55 | 900K | |
![[ ]](/icons/layout.gif) | History-of-Friedrich-II-of-Prussia-Volume-13.pdf | 2021-04-14 15:34 | 783K | |
![[ ]](/icons/layout.gif) | History-of-Friedrich-II-of-Prussia-Volume-14 (1).pdf | 2021-04-14 15:55 | 767K | |
![[ ]](/icons/layout.gif) | History-of-Friedrich-II-of-Prussia-Volume-14.pdf | 2021-04-14 15:55 | 767K | |
![[ ]](/icons/layout.gif) | History-of-Friedrich-II-of-Prussia-Volume-16.pdf | 2021-04-14 15:55 | 1.0M | |
![[ ]](/icons/layout.gif) | History-of-Friedrich-II-of-Prussia-Volume-18.pdf | 2021-04-14 15:54 | 1.3M | |
![[ ]](/icons/layout.gif) | History-of-Friedrich-II-of-Prussia-Volume-20.pdf | 2021-04-14 15:54 | 1.2M | |
![[ ]](/icons/layout.gif) | History-of-Friedrich-II-of-Prussia-Volume-21.pdf | 2021-04-14 15:54 | 1.3M | |
![[ ]](/icons/layout.gif) | History-of-the-Decline-and-Fall-of-the-Roman-Empire-Volume-2.pdf | 2021-04-14 15:33 | 3.5M | |
![[ ]](/icons/layout.gif) | History-of-the-Decline-and-Fall-of-the-Roman-Empire-Volume-3.pdf | 2021-04-14 15:54 | 1.7M | |
![[ ]](/icons/layout.gif) | History-of-the-Decline-and-Fall-of-the-Roman-Empire-Volume-4.pdf | 2021-04-14 15:28 | 3.2M | |
![[ ]](/icons/layout.gif) | History-of-the-Decline-and-Fall-of-the-Roman-Empire-Volume-6.pdf | 2021-04-14 15:27 | 3.0M | |
![[ ]](/icons/layout.gif) | History-of-the-United-Netherlands-1586-89-Complete.pdf | 2021-04-14 15:54 | 1.9M | |
![[ ]](/icons/layout.gif) | History-of-the-United-Netherlands-from-the-Death-of-William-the-Silent-to-the-Twelve-Years-Truce-Complete-1600-1609.pdf | 2021-04-14 15:54 | 2.0M | |
![[ ]](/icons/layout.gif) | History-of-the-World-War-Vol-3.pdf | 2021-04-14 14:47 | 1.8M | |
![[ ]](/icons/layout.gif) | History at the limit world history.pdf | 2022-12-04 05:27 | 544K | |
![[ ]](/icons/layout.gif) | History of Africa 3rd edition.pdf | 2022-12-04 05:27 | 142K | |
![[ ]](/icons/layout.gif) | History of Rome Volume 1 by Nieubuhr, G. B.pdf | 2018-10-04 09:21 | 23M | |
![[ ]](/icons/layout.gif) | History of Rwanda fron the beginning to 20th century.pdf | 2017-02-09 07:08 | 23M | |
![[ ]](/icons/layout.gif) | History of Sudan by Gemma, Pitcher(BookLid.org).pdf | 2022-12-04 05:27 | 446K | |
![[ ]](/icons/layout.gif) | History of the Cambodian Genocide 1.pdf | 2022-12-04 05:27 | 5.8M | |
![[ ]](/icons/layout.gif) | History of the Cambodian Genocide 2.pdf | 2022-12-04 05:27 | 222K | |
![[ ]](/icons/layout.gif) | Hitler's study of a Revolution by Martyn, Housden(BookFi).pdf | 2018-09-24 17:19 | 2.8M | |
![[ ]](/icons/layout.gif) | In-the-World-War.pdf | 2021-04-14 15:50 | 1.9M | |
![[ ]](/icons/layout.gif) | Introduction The French Revolution and the Napoleonic.pdf | 2022-12-04 05:27 | 497K | |
![[ ]](/icons/layout.gif) | Irish-Race-in-the-Past-and-the-Present.pdf | 2021-04-14 15:50 | 1.5M | |
![[ ]](/icons/layout.gif) | Islam and Social Change in French by Sean, Hanretta(BookLid.org).pdf | 2022-12-04 05:27 | 2.3M | |
![[ ]](/icons/layout.gif) | Italy-at-War-and-the-Allies-in-the-West.pdf | 2021-04-14 15:50 | 2.2M | |
![[ ]](/icons/layout.gif) | KHMER ROUGE AND THE CRIMES OF GENOCIDE.pdf | 2022-12-04 05:27 | 1.3M | |
![[ ]](/icons/layout.gif) | Kelly-Millers-History-of-the-World-War-for-Human-Rights.pdf | 2021-04-14 15:20 | 6.7M | |
![[ ]](/icons/layout.gif) | Khartoum-Campaign-1898-or-the-Re-Conquest-of-the-Soudan.pdf | 2021-04-14 15:32 | 2.5M | |
![[ ]](/icons/layout.gif) | King-Alfred-of-England-Makers-of-History.pdf | 2021-04-14 15:50 | 1.6M | |
![[ ]](/icons/layout.gif) | Koreas-Fight-for-Freedom.pdf | 2021-04-14 15:50 | 790K | |
![[ ]](/icons/layout.gif) | Le-genocide-des-tutsi-rwanda-1994-lectures-et-ecri.pdf | 2022-12-04 05:27 | 11M | |
![[ ]](/icons/layout.gif) | Leave None to Tell by Liebhafsky, Alison(BookFi).pdf | 2022-12-04 05:27 | 1.4M | |
![[ ]](/icons/layout.gif) | Lectures-on-the-French-Revolution.pdf | 2021-04-14 15:31 | 1.3M | |
![[ ]](/icons/layout.gif) | Le genocide desTutsi,R by Catalina, Sagarra(BookFi).pdf | 2022-12-04 05:27 | 11M | |
![[ ]](/icons/layout.gif) | Louis-XIV-Makers-of-History-Series.pdf | 2021-04-14 15:50 | 3.1M | |
![[ ]](/icons/layout.gif) | Mediaeval-Socialism.pdf | 2021-04-14 15:50 | 415K | |
![[ ]](/icons/layout.gif) | Migration history in world history studies Multidisciplinary Approaches in global social history.pdf.pdf | 2022-12-04 05:27 | 5.4M | |
![[ ]](/icons/layout.gif) | Mirror-to-the-church-resurrecting-faith-after-geno.pdf | 2022-12-04 05:27 | 6.1M | |
![[ ]](/icons/layout.gif) | Muslim societies in African history.pdf | 2022-12-04 05:27 | 3.6M | |
![[ ]](/icons/layout.gif) | Napoleon, A biography 2003 by Mclynn, Frank.pdf | 2022-12-04 05:27 | 9.6M | |
![[ ]](/icons/layout.gif) | Napoleon-Background.pdf | 2022-12-04 05:27 | 450K | |
![[ ]](/icons/layout.gif) | Napoleon-the-Little.pdf | 2021-04-14 15:50 | 1.1M | |
![[ ]](/icons/layout.gif) | Napoleon. Bonaparte 1769- 1821.pdf | 2022-12-04 05:27 | 1.8M | |
![[ ]](/icons/layout.gif) | Nationalism in Europe 1815 to the present, A reader.pdf | 2022-12-04 05:27 | 2.1M | |
![[ ]](/icons/layout.gif) | Negro-Migration-during-the-War.pdf | 2021-04-14 16:19 | 1.0M | |
![[ ]](/icons/layout.gif) | Neo-colonialism-in-west-africa.pdf | 2022-12-04 05:27 | 16M | |
![[ ]](/icons/layout.gif) | New Homelands Hindu Communities in Mauritus by Paul, Younger(BookLid.org).pdf | 2022-12-04 05:27 | 5.5M | |
![[ ]](/icons/layout.gif) | On the causes of African Slave Trade by Angeles, Luis.pdf | 2022-12-04 05:27 | 283K | |
![[ ]](/icons/layout.gif) | PeaceFocus_RwandaReconciliationReintegration_EN_2016.pdf | 2021-02-25 21:24 | 376K | |
![[ ]](/icons/layout.gif) | Performing Africa.pdf | 2022-12-04 05:27 | 670K | |
![[ ]](/icons/layout.gif) | Political and Economic Dictionary of Africa by David, Seddon(BookLid.org).pdf | 2018-11-03 09:44 | 2.9M | |
![[ ]](/icons/layout.gif) | Politics and Population Control by Kathleen, A.(BookFi).pdf | 2022-12-04 05:27 | 2.3M | |
![[ ]](/icons/layout.gif) | Portuguese-africa-and-the-west.pdf | 2022-12-04 05:27 | 16M | |
![[ ]](/icons/layout.gif) | Queen Victoria's Enemies North Africa by Ian, Knight(BookLid.org).pdf | 2018-11-03 09:54 | 23M | |
![[ ]](/icons/layout.gif) | Reconciliation and peace-building in post genocide societies A structured focused comparison in Rwanda and Cambodia.pdf | 2021-02-25 21:25 | 1.1M | |
![[ ]](/icons/layout.gif) | Reimaging Rwanda conflict, survival and disinformation in the late twentieth century.pdf | 2022-12-04 05:27 | 1.7M | |
![[ ]](/icons/layout.gif) | Remaking Rwanda, State building and human rights after mass violence.pdf | 2022-12-04 05:27 | 1.4M | |
![[ ]](/icons/layout.gif) | Rwanda-a-fascinating-story-of-man-and-gorilla.pdf | 2022-12-04 05:27 | 9.5M | |
![[ ]](/icons/layout.gif) | Shackled to the past-The causes and consequences of Africa's slave trade.pdf | 2022-12-04 05:27 | 260K | |
![[ ]](/icons/layout.gif) | Slavery-and-Four-Years-of-War-Vol-1-2-A-Political-History-of-Slavery-in-the-United-States-Together-With-a-Narrative-of-the-Campaigns-and-Battles-of.pdf | 2021-04-14 15:31 | 1.8M | |
![[ ]](/icons/layout.gif) | South-America.pdf | 2021-04-14 15:29 | 4.7M | |
![[ ]](/icons/layout.gif) | South-west-africa.pdf | 2022-12-04 05:27 | 4.1M | |
![[ ]](/icons/layout.gif) | Surgical-Experiences-in-South-Africa-1899-1900-Being-Mainly-a-Clinical-Study-of-the-Nature-and-Effects-of-Injuries-Produced-by-Bullets-of-Small.pdf | 2021-04-14 15:28 | 9.6M | |
![[ ]](/icons/layout.gif) | THE OXFORD HISTORY OF THE BRITISH EMPIRE - Higher Intellect ( PDFDrive.com ).pdf | 2022-12-04 05:27 | 3.2M | |
![[ ]](/icons/layout.gif) | The-Abolition-Of-Slavery-The-Right-Of-The-Government-Under-The-War-Power.pdf | 2021-04-14 16:06 | 278K | |
![[ ]](/icons/layout.gif) | The-American-Indian-as-Participant-in-the-Civil-War.pdf | 2021-04-14 15:50 | 2.3M | |
![[ ]](/icons/layout.gif) | The-Beginners-American-History.pdf | 2021-04-14 15:19 | 12M | |
![[ ]](/icons/layout.gif) | The-Conquest-of-Canada-Vol-1-of-2.pdf | 2021-04-14 15:43 | 1.5M | |
![[ ]](/icons/layout.gif) | The-Development-of-the-European-Nations-1870-1914-5th-ed.pdf | 2021-04-14 15:32 | 4.5M | |
![[ ]](/icons/layout.gif) | The-Empire-of-Austria-Its-Rise-and-Present-Power.pdf | 2021-04-14 15:43 | 1.7M | |
![[ ]](/icons/layout.gif) | The-English-Utilitarians-Volume-II-of-3-James-Mill.pdf | 2021-04-14 15:43 | 1.0M | |
![[ ]](/icons/layout.gif) | The-Eve-of-the-Revolution-a-chronicle-of-the-breach-with-England.pdf | 2021-04-14 15:42 | 643K | |
![[ ]](/icons/layout.gif) | The-Evolution-of-Modern-Capitalism-A-Study-of-Machine-Production.pdf | 2021-04-14 15:28 | 4.3M | |
![[ ]](/icons/layout.gif) | The-French-Revolution-Volume-1.pdf | 2021-04-14 15:41 | 1.8M | |
![[ ]](/icons/layout.gif) | The-French-Revolution-Volume-2.pdf | 2021-04-14 15:41 | 2.1M | |
![[ ]](/icons/layout.gif) | The-Frontier-in-American-History.pdf | 2021-04-14 15:41 | 1.4M | |
![[ ]](/icons/layout.gif) | The-Great-Boer-War.pdf | 2021-04-14 15:41 | 2.0M | |
![[ ]](/icons/layout.gif) | The-History-of-Cuba-vol-4.pdf | 2021-04-14 15:27 | 4.7M | |
![[ ]](/icons/layout.gif) | The-History-of-England-from-the-Accession-of-James-II-Volume-1.pdf | 2021-04-14 15:26 | 2.1M | |
![[ ]](/icons/layout.gif) | The-History-of-England-in-Three-Volumes-Vol-I-Part-C-From-Henry-VII-to-Mary.pdf | 2021-04-14 15:05 | 2.9M | |
![[ ]](/icons/layout.gif) | The-History-of-England-in-Three-Volumes-Vol-II-From-William-and-Mary-to-George-II.pdf | 2021-04-14 15:21 | 14M | |
![[ ]](/icons/layout.gif) | The-History-of-London.pdf | 2021-04-14 15:22 | 6.2M | |
![[ ]](/icons/layout.gif) | The-Influence-of-Sea-Power-Upon-History-1660-1783.pdf | 2021-04-14 15:22 | 3.4M | |
![[ ]](/icons/layout.gif) | The-Last-Voyage-to-India-and-Australia-in-the-Sunbeam.pdf | 2021-04-14 15:19 | 10M | |
![[ ]](/icons/layout.gif) | The-Life-of-Napoleon-Bonaparte-Vol-III-of-IV.pdf | 2021-04-14 15:40 | 2.5M | |
![[ ]](/icons/layout.gif) | The-Major-Operations-of-the-Navies-in-the-War-of-American-Independence.pdf | 2021-04-14 15:28 | 3.6M | |
![[ ]](/icons/layout.gif) | The-Negro-Problem.pdf | 2021-04-14 15:40 | 1.0M | |
![[ ]](/icons/layout.gif) | The-Philippine-Islands-1493-1803-Volume-02-of-55-1521-1569-Explorations-by-Early-Navigators-Descriptions-of-the-Islands-and-Their-Peoples-Their.pdf | 2021-04-14 15:40 | 751K | |
![[ ]](/icons/layout.gif) | The-Philippine-Islands-1493-1898-Volume-18-of-55-1617-1620-Explorations-by-Early-Navigators-Descriptions-of-the-Islands-and-Their-Peoples-Their.pdf | 2021-04-14 15:40 | 871K | |
![[ ]](/icons/layout.gif) | The-Reign-of-Mary-Tudor.pdf | 2021-04-14 15:40 | 1.7M | |
![[ ]](/icons/layout.gif) | The-Rise-and-Fall-of-the-Confederate-Government.pdf | 2021-04-14 15:40 | 3.2M | |
![[ ]](/icons/layout.gif) | The-Rise-of-the-Dutch-Republic-Complete-1566-74.pdf | 2021-04-14 15:40 | 2.0M | |
![[ ]](/icons/layout.gif) | The-Roman-History-of-Ammianus-Marcellinus-During-the-Reigns-of-the-Emperors-Constantius-Julian-Jovianus-Valentinian-and-Valens.pdf | 2021-04-14 15:40 | 1.8M | |
![[ ]](/icons/layout.gif) | The-Seven-Great-Monarchies-Of-The-Ancient-Eastern-World-Vol-2-of-7-Assyria-The-History-Geography-And-Antiquities-Of-Chaldaea-Assyria-Babylon-Media.pdf | 2021-04-14 15:17 | 17M | |
![[ ]](/icons/layout.gif) | The-Seven-Great-Monarchies-Of-The-Ancient-Eastern-World-Vol-6-of-7-Parthia-The-History-Geography-And-Antiquities-Of-Chaldaea-Assyria-Babylon-Media.pdf | 2021-04-14 15:18 | 1.9M | |
![[ ]](/icons/layout.gif) | The-Story-of-Norway.pdf | 2021-04-14 15:09 | 10M | |
![[ ]](/icons/layout.gif) | The-Story-of-Rome-from-the-Earliest-Times-to-the-End-of-the-Republic.pdf | 2021-04-14 16:06 | 755K | |
![[ ]](/icons/layout.gif) | The-Thirty-Years-War-Complete.pdf | 2021-04-14 15:37 | 2.2M | |
![[ ]](/icons/layout.gif) | The-United-States-of-America-Part-1.pdf | 2021-04-14 16:05 | 936K | |
![[ ]](/icons/layout.gif) | The-Uprising-of-a-Great-People-The-United-States-in-1861-to-Which-is-Added-a-Word-of-Peace-on-the-Difference-Between-England-the-United-States.pdf | 2021-04-14 16:05 | 637K | |
![[ ]](/icons/layout.gif) | The-War-of-Independence.pdf | 2021-04-14 15:37 | 1.3M | |
![[ ]](/icons/layout.gif) | The-World-War-and-What-was-Behind-It-Or-the-Story-of-the-Map-of-Europe.pdf | 2021-04-14 15:21 | 3.7M | |
![[ ]](/icons/layout.gif) | The-Worlds-Greatest-Books-Volume-11-Ancient-and-Medi-val-History.pdf | 2021-04-14 15:17 | 1.1M | |
![[ ]](/icons/layout.gif) | The-Worlds-Greatest-Books-Volume-12-Modern-History.pdf | 2021-04-14 15:37 | 1.2M | |
![[ ]](/icons/layout.gif) | The-autobiography-of-nelson-mandela.pdf | 2019-01-24 11:53 | 3.9M | |
![[ ]](/icons/layout.gif) | The African slave trade from the fifteenth to the nineteenth century.pdf | 2018-10-17 09:44 | 17M | |
![[ ]](/icons/layout.gif) | The Balkans and North Africa 1941 - 1942 by Flower, Will(BookLid.org).pdf | 2018-11-03 09:44 | 16M | |
![[ ]](/icons/layout.gif) | The Decisive Battles of the World History, Course Guidebook.pdf | 2022-12-04 05:27 | 19M | |
![[ ]](/icons/layout.gif) | The Family in Life and in Death by Dutcher, Walls(BookLid.org).pdf | 2022-12-04 05:27 | 6.7M | |
![[ ]](/icons/layout.gif) | The First Holocaust by Martin, H.G.pdf | 2014-10-10 12:04 | 3.8M | |
![[ ]](/icons/layout.gif) | The French revolution and Napoleon 1789- 1815 chap11.pdf | 2018-10-16 15:59 | 13M | |
![[ ]](/icons/layout.gif) | The Life Of Napoleon Vol 1 by HOlland, John text.pdf | 2022-12-04 05:27 | 14M | |
![[ ]](/icons/layout.gif) | The Pen Pictures Of Modern Africa by Doortmont, Michel(BookFi).pdf | 2022-12-04 05:27 | 4.2M | |
![[ ]](/icons/layout.gif) | The Psychology of Genocide and Violent Oppression_ A Study of Mass Cruelty from Nazi Germany to Rwanda ( PDFDrive.com ).pdf | 2022-12-04 05:27 | 11M | |
![[ ]](/icons/layout.gif) | The Psychology of Genocide by Richard Morrock (BookFi).pdf | 2022-12-04 05:27 | 11M | |
![[ ]](/icons/layout.gif) | The War 1812 Independence by Callaway, G.H.pdf | 2022-12-04 05:27 | 229K | |
![[ ]](/icons/layout.gif) | The autobiography of Nelson mandela.pdf | 2022-12-04 05:27 | 3.9M | |
![[ ]](/icons/layout.gif) | The autobiography of Nelson mandela.pdf.pdf | 2022-12-04 05:27 | 3.9M | |
![[ ]](/icons/layout.gif) | The general history of Africa - studies and documents 4 ( PDFDrive.com ).pdf | 2022-12-04 05:27 | 5.0M | |
![[ ]](/icons/layout.gif) | The history of China 2nd edition [David, Curtis W].pdf.pdf | 2022-12-04 05:27 | 1.9M | |
![[ ]](/icons/layout.gif) | The history of china understanding china.pdf.pdf | 2022-12-04 05:27 | 9.7M | |
![[ ]](/icons/layout.gif) | The longterm effects of slave trade by Nathan, Nunn.pdf | 2022-12-04 05:27 | 3.0M | |
![[ ]](/icons/layout.gif) | The partion of Africa by Scott, J.pdf | 2019-01-24 14:16 | 67M | |
![[ ]](/icons/layout.gif) | The partion of Africa by Scott, J.pdf.pdf | 2022-12-04 05:27 | 67M | |
![[ ]](/icons/layout.gif) | The strategy of Antelopes, Rwanda after Genocide.pdf | 2022-12-04 05:27 | 1.2M | |
![[ ]](/icons/layout.gif) | Twenty-Years-Of-Balkan-Tangle.pdf | 2021-04-14 15:35 | 892K | |
![[ ]](/icons/layout.gif) | Vanishing-England.pdf | 2021-04-14 15:12 | 14M | |
![[ ]](/icons/layout.gif) | Voices in Britain during the Napoleonic Wars by Jane , Austen.pdf | 2022-12-04 05:27 | 265K | |
![[ ]](/icons/layout.gif) | Warrior People Of East Africa 1840-1900 by Peers, Chris(BookLid.org).pdf | 2022-12-04 05:27 | 11M | |
![[ ]](/icons/layout.gif) | Why Is the Twentieth Century of Genocide by Levene, Mark.pdf | 2022-12-04 05:27 | 3.7M | |
![[ ]](/icons/layout.gif) | William-the-Conqueror-Makers-of-History.pdf | 2021-04-14 16:05 | 1.2M | |
![[ ]](/icons/layout.gif) | With-the-Boer-Forces.pdf | 2021-04-14 15:21 | 2.6M | |
![[ ]](/icons/layout.gif) | Women-of-Modern-France.pdf | 2021-04-14 16:05 | 1.2M | |
![[ ]](/icons/layout.gif) | Worldmark Encyclopedia of the Nations-United Nations.pdf | 2022-12-04 05:27 | 5.3M | |
![[ ]](/icons/layout.gif) | Young-Folks-History-of-Rome.pdf | 2021-04-14 15:18 | 8.7M | |
|