![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|---|
|
|---|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[ ]](/icons/layout.gif) | 1 Medical Mycology manual PGIMER.pdf | 2022-12-04 05:27 | 2.2M | |
| 100-Cases-In-Obstetrics-And-Gynaecology (1).pdf | 2022-12-04 05:27 | 2.9M | |
| 249-Oxford American Handbook of Clinical Examination and Practical Skills (Oxford American Handbo.pdf | 2022-12-04 05:27 | 4.1M | |
| Accountability_in_Nursing and Midwifery 2nd ed.[Tilley,Stephen.]pdf(BookFi).pdf | 2022-12-04 05:27 | 907K | |
| Accountability in Nursing and Midwifery 2nd ed.[Tilley,Stephen.]pdf(BookFi).pdf | 2022-12-04 05:27 | 907K | |
| Adult Infectious Diseases Over 200 Case Studies_ Intended For_ Medical Students, Ambulists, Hospitalists, Nurse Practitioners, Physician Assistants ( PDFDrive ).pdf | 2022-12-04 05:27 | 6.4M | |
| Advance Infusion technology and Excellence nursing.pdf | 2022-12-04 05:27 | 182K | |
| Advanced Practice Nursing , Emphasizing Common Roles..pdf | 2022-12-04 05:27 | 4.6M | |
| Advanced Practice Nursing - Blair, Kathryn A. [SRG].pdf | 2022-12-04 05:27 | 2.2M | |
| Advanced nursing practice a futures model derived from narrative analysis of nurses stories.pdf | 2022-12-04 05:27 | 682K | |
| An-introduction-to-community-health.pdf | 2022-12-04 05:27 | 12M | |
| An Atlas of General Pathology Vol I , With Special Reference to Swine Diseases.[King.J.M.]pdf.pdf | 2022-12-04 05:27 | 30M | |
| An_Introduction_to_Epidemiology_for_Health_Professionals.pdf | 2022-12-04 05:27 | 1.6M | |
| An evidence base for Ophthalmic Nursing Practice. [ Marsden, Janet].pdf.pdf | 2022-12-04 05:27 | 1.1M | |
| Antibody(Ab)-Antigen(Ag) interactions.pdf | 2022-12-04 05:27 | 1.3M | |
| Basic nursing arts final.pdf | 2022-12-04 05:27 | 448K | |
| Bedside_Nursing_Process_notes.pdf | 2022-12-04 05:27 | 82K | |
| Brain-Behavior-Easy-Intro_Neuropsychology.pdf | 2022-12-04 05:27 | 8.9M | |
| Brain and Human Body Modeling 2020.pdf | 2021-05-18 17:00 | 20M | |
| Brunner and suddarths handbook of Laboratory.pdf.pdf | 2022-12-04 05:27 | 3.2M | |
| CHS 322 Community MOBILIZATION & PARTICIPATION.pdf | 2022-12-04 05:27 | 249K | |
| CHS 505 COMMUNITY MENTAL HEALTH.pdf | 2022-12-04 05:27 | 1.0M | |
| Cancer systems biology bioinformatics and medicine.[ Cesario, Alfredo].pdf | 2022-12-04 05:27 | 15M | |
![[ ]](/icons/unknown.gif) | Care Needed Improving the Lives of People with Dementia .pdf.Pdf | 2022-12-04 05:27 | 3.2M | |
| Care in Healthcare, Reflections on Theory and Practice edited by Franziska, krause..pdf | 2021-05-19 10:47 | 2.7M | |
| Caring for Children and Families (Wiley Series in Nursing).pdf | 2022-12-04 05:27 | 3.4M | |
| Caring for People with disabilities [ Peate, Ian].pdf | 2022-12-04 05:27 | 1.8M | |
| Case Files Pharmacology, 3rd Edition.pdf.pdf | 2022-12-04 05:27 | 3.2M | |
| Chemical Pathology MBChB student lecture notes.pdf | 2022-12-04 05:27 | 6.1M | |
| Clinical Application of Nursing Diagnoses.pdf | 2022-12-04 05:27 | 7.5M | |
| Clinical Laboratory Investigation2.pdf | 2022-12-04 05:27 | 4.6M | |
| Clinical Mycology - Dismukes, William E.; Pappas, _1359.pdf | 2022-12-04 05:27 | 3.6M | |
| Clinical Nature Medecine Handbook .[Meletis, Chris.D].pdf.pdf | 2022-12-04 05:27 | 2.8M | |
| Clinical pathways in stroke rehabilitation, Evidence-based clinical practice recommendations edited by Thomas, Platz..pdf | 2021-05-18 16:14 | 3.9M | |
| Clinician's Pocket drug reference 2008. [ Gomella, Leonard G.].pdf.pdf | 2022-12-04 05:27 | 2.8M | |
| Clinician's pocket drug reference 2009. [Gomella, Leonard. G.].pdf | 2022-12-04 05:27 | 2.2M | |
| Coeliac Desease, Nursing and Management[Griffiths, Helen].pdf.pdf | 2022-12-04 05:27 | 1.8M | |
| Coeliac disease nursing care-and management-wiley [Helen Griffiths MSc, RGN, Cert MHSC].pdf | 2022-12-04 05:27 | 1.8M | |
| Cognitive Psychology.pdf | 2022-12-04 05:27 | 11M | |
| Color Atlas of Pharmacology, 2nd ed.pdf.pdf | 2022-12-04 05:27 | 9.9M | |
| Communicable Diseases.pdf | 2022-12-04 05:27 | 621K | |
| Communicable_Diseases_Part_4.lo.pdf | 2022-12-04 05:27 | 2.0M | |
| Community-Health-Nursing-Nursing-Online-Readiness-Questionaire.pdf | 2022-12-04 05:27 | 144K | |
| Community Health Care Nursing.Sines, David.pdf | 2022-12-04 05:27 | 1.6M | |
| Community Health Diagnosis in Nursing.pdf | 2022-12-04 05:27 | 915K | |
| Community_Analysis_in_Community_Health_N.pdf | 2022-12-04 05:27 | 505K | |
| Community_Health_Nursing.pdf | 2022-12-04 05:27 | 298K | |
| Community and Public Health Nursing, 5E - Sines, David, Aldridge-Bent, Sharon, Fanning, Agnes [SRG].pdf | 2022-12-04 05:27 | 2.6M | |
| Complement System ok.pdf | 2022-12-04 05:27 | 1.6M | |
| Complete Denture Prosthetics; A Guide for Students and Practitioners. [Lamb, David J.].pdf | 2022-12-04 05:27 | 1.0M | |
| Comprehensive Nursing Care for Parkinson's Desease.pdf.pdf | 2022-12-04 05:27 | 2.7M | |
| Comprehensive Nursing Care in Multiple Sclerosis 2nd .[Halper, June.].pdf | 2022-12-04 05:27 | 1.8M | |
| Comprehensive Systematic Review for Advanced Nursing Practice.[Holly, Cheryl.] .pdf | 2022-12-04 05:27 | 2.6M | |
| Concept of Public Health & Community Health Nursing.pdf | 2022-12-04 05:27 | 4.1M | |
| Concise Behavioural Sciences for Nursing.pdf | 2022-12-04 05:27 | 1.7M | |
| Contexts of Contemporary Nursing, Graham R. Williamson, Tim Jenkinson and Tracey Proctor-Childs.pdf | 2022-12-04 05:27 | 1.0M | |
| Critical Care Nursing.pdf | 2022-12-04 05:27 | 3.1M | |
| Critical Care Nursing of Older Adults - Best Practices, 3rd Edition-Marquis D. Foreman Koen M.pdf | 2022-12-04 05:27 | 3.4M | |
| Current Essentials - Pediatrics.pdf | 2022-12-04 05:27 | 2.5M | |
| Current Essentials of Surgery.pdf | 2022-12-04 05:27 | 1.7M | |
| CurtisPsychiatricMentalHealthNursingSuccessACourse Re.pdf | 2022-12-04 05:27 | 2.3M | |
| Davis's comprehensive handbook of laboratory and Diagnostic tests.pdf.pdf | 2022-12-04 05:27 | 21M | |
| Day Surgery , Contemprary Approaches to Nursing Care..pdf | 2022-12-04 05:27 | 1.0M | |
| Delmar's Dental ,Drug Reference.pdf.pdf | 2022-12-04 05:27 | 2.2M | |
| Dental ethics and laws. [Paul, Lambden].pdf | 2022-12-04 05:27 | 1.0M | |
| Dental management of sleep disorders [Ronald, Attanasio, DDS, MSEd, MS].pdf | 2022-12-04 05:27 | 9.1M | |
| Diabetes in pregnancy.pdf | 2022-12-04 05:27 | 2.5M | |
| Diagnosis of Fungal Infections (Informa, 2007).pdf | 2022-12-04 05:27 | 9.4M | |
| Dictionary of nursing - A.pdf | 2022-12-04 05:27 | 12M | |
| Disability, Health and Human Development by Sophie Mitra.pdf | 2021-05-19 11:36 | 3.2M | |
| Diseases And Disorders A Nursing Therapeutics Manual.pdf | 2022-12-04 05:27 | 12M | |
| Diseases and Disorders Chronic Fatique Syndrome .[Abrams ,Liesa].pdf.pdf | 2022-12-04 05:27 | 4.9M | |
| Diseases of the Abdomen and Pelvis 2018–2021 Diagnostic Imaging - IDKD Book edited by Juerg Hodler.pdf | 2021-05-19 11:26 | 25M | |
| Documentation-in-Nursing-and-Midwifery-Australian-edition-1646112041._print.pdf | 2023-01-06 15:24 | 922K | |
| Dossey_Theory_of_Integral_Nursing_powerpoint.pdf | 2022-12-04 05:27 | 1.1M | |
| Drugs in Use, 4th ed [Dodds, Linda].pdf.pdf | 2022-12-04 05:27 | 2.6M | |
| Dual Diagnosis Nursing [Rassool, Hussein].pdf.pdf | 2022-12-04 05:27 | 1.8M | |
| EDUCATIONAL AND CURRICULUM DESIGN.pdf | 2022-12-04 05:27 | 923K | |
| ENVIRONMENTAL HEALTH AND DISEASE.pdf | 2022-12-04 05:27 | 738K | |
| EPIDEMIOLOGY FOR COMMUNITY HEALTH.pdf | 2022-12-04 05:27 | 862K | |
| EPIDEMIOLOGY IN NURSING.pdf | 2022-12-04 05:27 | 1.3M | |
| Ebola (Deadly Diseases and Epidemics) ( PDFDrive ).pdf | 2022-12-04 05:27 | 2.8M | |
| EbolaVirusHaemorragicFever-SPattyn.pdf | 2022-12-04 05:27 | 5.5M | |
| Ebola virus disease _ from origin to outbreak ( PDFDrive ).pdf | 2022-12-04 05:27 | 9.9M | |
| Effective Leadership and Management in Nursing - Sullivan, Eleanor J. [SRG].pdf | 2022-12-04 05:27 | 5.2M | |
| Encyclopedia of Molecular Pharmacology (Vol 1 & 2) 2nd Edition.Pdf | 2022-12-04 05:27 | 32M | |
| English-as-a-Second Language (ESL) nursing students.. strategies for building verbal and written language skills.pdf | 2022-12-04 05:27 | 965K | |
| Essentials of Critical Care Nursing 2006.pdf | 2022-12-04 05:27 | 2.6M | |
| Evaluation and testing in Nurse Education.pdf | 2022-12-04 05:27 | 1.0M | |
| Evidence Use in Health Policy Making, An International Public Policy Perspective edited by Justin Parkhurst.pdf | 2021-05-19 11:45 | 2.5M | |
| Exploration in Family Nursing .[Whtyte,Dororty.A.].pdf.pdf | 2022-12-04 05:27 | 1.0M | |
| FUNDAMENTAL OF NURSING.pdf | 2022-12-04 05:27 | 3.4M | |
| Factors Affecting Practical Nursing Student Attrition.pdf | 2022-12-04 05:27 | 146K | |
| Factors affecting decision making in nursing.pdf | 2022-12-04 05:27 | 412K | |
| FamilyHealthCare2010,Book.pdf | 2022-12-04 05:27 | 5.4M | |
| Family planning Fundamentals for health professionals.pdf | 2022-12-04 05:27 | 6.5M | |
| Forensic_Pharmacology [Zedeck,Beth].pdf.pdf | 2022-12-04 05:27 | 6.2M | |
| Forensic_mental_health_nursing.pdf | 2022-12-04 05:27 | 6.3M | |
| Foundations in Nursing and Health Care [Wigens, Lynne].pdf | 2022-12-04 05:27 | 2.4M | |
| Fragility Fracture Nursing, Holistic Care and Management of the Orthogeriatric Patient edited by Karen, Hertz..pdf | 2021-05-19 10:49 | 2.3M | |
| Fundamental Nursing skills.pdf | 2022-12-04 05:27 | 1.2M | |
| Fundamental_Nursing_Skills-_2005By_Penny_Hilton_.pdf | 2022-12-04 05:27 | 1.2M | |
| Fundamentals of Nursing.pdf | 2022-12-04 05:27 | 3.4M | |
| Gastrointestinal Nursing.pdf | 2022-12-04 05:27 | 4.3M | |
| General pathology.pdf | 2022-12-04 05:27 | 897K | |
| General pharmacology [Habil, Med].pdf.PDF | 2022-12-04 05:27 | 218K | |
| Geriatric and Genrotology.pdf | 2022-12-04 05:27 | 714K | |
| Guidelines for Evaluating Basic Nursing and Midwifery Education and Training Programmes.pdf | 2022-12-04 05:27 | 410K | |
| Gynaecology; Changing services for changing needs. [ Jolley, Sue.].pdf.pdf | 2022-12-04 05:27 | 1.6M | |
| HEALTH COUNSELLING.pdf | 2022-12-04 05:27 | 619K | |
![[DIR]](/icons/folder.gif) | HHH/ | 2023-01-07 14:25 | - | |
| Hamilton Fairley Obstetrics and Gynaecology Lecture Notes 2 Ed.pdf | 2022-12-04 05:27 | 5.9M | |
| Handbook for Brunner and Suddarth's Textbook of Medical-Surgical Nursing, 12th Edition-Suzann_2.pdf | 2022-12-04 05:27 | 5.0M | |
| Handbook of Pathogens and Diseases in Cephalopods edited by Camino, Gestal..pdf | 2021-05-19 10:12 | 37M | |
| Handbook of Tourettes's Syndrome and Related Tics and Behaviaral Disorders.2nd ed [Kurlan, Roger.]pdf.pdf | 2022-12-04 05:27 | 6.0M | |
| Harrisons-infectious-diseases.pdf | 2022-12-04 05:27 | 38M | |
| Health Economics.pdf | 2022-12-04 05:27 | 711K | |
| Health Education and Health Promotion Bode Kayode.pdf | 2022-12-04 05:27 | 134K | |
| Health Mgt Information System.pdf | 2022-12-04 05:27 | 272K | |
| Heart Failure , A Clinical Nursing Handbook .pdf | 2022-12-04 05:27 | 1.1M | |
| Holistic Nursing A Handbook for Practice, 4th Edition.pdf | 2022-12-04 05:27 | 8.0M | |
| Human PARASITOLOGY in tropical setting.pdf | 2022-12-04 05:27 | 6.0M | |
| INTRODUCTION TO BIOSTATISTICS.pdf | 2022-12-04 05:27 | 496K | |
| Immunology Fifth Edition.pdf | 2022-12-04 05:27 | 22M | |
| Immunology and Immunization (1).pdf | 2022-12-04 05:27 | 1.0M | |
| Immunology and serology book.pdf | 2022-12-04 05:27 | 427K | |
| Improving Quality of care in family planning(z-lib.org).pdf | 2022-12-04 05:27 | 4.0M | |
| Intensive-care-nursing-a-framework-for-practice. [ Philip, Woodrow].pdf | 2022-12-04 05:27 | 4.8M | |
| Internationa lPerspectives in values-based mental health practice.pdf | 2021-05-18 16:08 | 6.8M | |
| Interventional Cardiology (Oxford American Cardiology Library) 1st Edition.Pdf | 2022-12-04 05:27 | 3.6M | |
| Interventional Strategies to Decrease nursing student anxiety in the clinical.pdf | 2022-12-04 05:27 | 178K | |
| Introduction to HIV AIDS.pdf | 2022-12-04 05:27 | 2.6M | |
| Introduction to Pharmacology.pdf.pdf | 2022-12-04 05:27 | 3.8M | |
| Introduction to Sociology.pdf | 2022-12-04 05:27 | 701K | |
| Intro to HIVAIDS.pdf | 2022-12-04 05:27 | 2.6M | |
| Intro to Organic Chemistry.pdf | 2022-12-04 05:27 | 2.6M | |
| Kawthalkar Essentials of Haematology.pdf | 2022-12-04 05:27 | 8.3M | |
| Key Nursing Skills (Workman) 2003,259p.pdf | 2022-12-04 05:27 | 3.5M | |
| LN_Immunohaematology_final.pdf | 2022-12-04 05:27 | 650K | |
| Learning Disability Nursing.[Turnbull, John].pdf | 2022-12-04 05:27 | 1.0M | |
| Lewis's_Medical_Surgical_Nursing_4e_Brown_and_Edwards_9780729541770_sample_chapter_web_2.pdf | 2022-12-04 05:27 | 6.0M | |
| Litt's drug eruption reference manual including drug interactions. 14th edition. [ Litti, Jerome.].pdf | 2022-12-04 05:27 | 3.6M | |
| Lung Biology in Health Disease(BookFi)[Oomen, P. Mathew].pdf | 2022-12-04 05:27 | 3.9M | |
| MANAGEMENT IN NURSING.pdf | 2022-12-04 05:27 | 915K | |
| MEDICAL PHARMACOLOGY AT A GLANCE.pdf | 2022-12-04 05:27 | 18M | |
| MEDICAL SOCIOLOGY.pdf | 2022-12-04 05:27 | 275K | |
| MEDICAL SURGICAL NURSING III.pdf | 2022-12-04 05:27 | 1.1M | |
| Manual in Operating Room Nursing 2011.pdf | 2022-12-04 05:27 | 5.6M | |
| Medical Microbiology_The Big Picture(BookZZ.org) - Copy.pdf | 2022-12-04 05:27 | 12M | |
| Medical Surgical Nursing Demystified.pdf.pdf | 2022-12-04 05:27 | 2.6M | |
| Medsurg nursing KEY POINTS lecture notes.pdf | 2022-12-04 05:27 | 1.4M | |
| Mens health the practice nurses handbook wiley [Ian, Peate].pdf | 2022-12-04 05:27 | 3.0M | |
| Microbiology- A Photographic Atlas CLINICAL PLACEMENT RMH - Copy.pdf | 2022-12-04 05:27 | 17M | |
| Microbiology Coloring Book_Microbiology.pdf | 2022-12-04 05:27 | 119K | |
| Model & theories of Nursing.pdf | 2022-12-04 05:27 | 300K | |
| Molecular Basis of Pulmonary Desease, Insights from RARE lung Disorders.[Mc Cormarck, Francis.x.]pdf.pdf | 2022-12-04 05:27 | 18M | |
| Molecular Pharmacology and Pathology of Strokes.pdf | 2022-12-04 05:27 | 26M | |
| Monica-Cheesbrough-District-Laboratory-Practice-in-Tropical-Countries-Part-1.pdf | 2022-12-04 05:27 | 6.5M | |
| Monica-Cheesbrough-Part-2.pdf.pdf | 2022-12-04 05:27 | 7.0M | |
| NANDA-APPROVED_NURSING.pdf | 2022-12-04 05:27 | 116K | |
| NON COMMUNICABLE CHRONIC DISEASES.pdf | 2022-12-04 05:27 | 398K | |
| NSS 305 EPIDEMIOLOGY IN NURSING.pdf | 2022-12-04 05:27 | 1.3M | |
| NSS 321 MEDICO-SURGICAL NURSING I.pdf | 2022-12-04 05:27 | 1.4M | |
| NSS 327 COMMUNITY HEALTH NURSING.pdf | 2022-12-04 05:27 | 376K | |
| NSS 401 MENTAL HEALTH AND PSYCHIATRIC.pdf | 2022-12-04 05:27 | 1.2M | |
| NSS 402 MENTAL HEALTH AND PSYCHIATRIC NURSING II.pdf | 2022-12-04 05:27 | 762K | |
| NSS 403 MEDICAL SURGICAL NURSING II.pdf | 2022-12-04 05:27 | 798K | |
| NSS 404 MEDICAL SURGICAL NURSING III.pdf | 2022-12-04 05:27 | 1.1M | |
| NSS 407 RESEARCH METHOD IN.pdf | 2022-12-04 05:27 | 558K | |
| Neglected Tropical Diseases - Sub-Saharan Africa ( PDFDrive ).pdf | 2022-12-04 05:27 | 11M | |
| Neonatal intensive care nursing [Boxwell, Glenys].pdf | 2022-12-04 05:27 | 4.8M | |
| New Developments Asthma Research .[D'aMATO, Gennaro.].pdf.pdf | 2022-12-04 05:27 | 1.6M | |
| Notes on Nursing by Florence Nightingale.pdf | 2022-12-04 05:27 | 287K | |
| Nurse's Pocket Drug Guide 2009 ( PDFDrive.com ).pdf | 2022-12-04 05:27 | 1.7M | |
| Nursing-Pharmacology-1610918370.pdf | 2021-05-17 19:15 | 125M | |
| Nursing-Skills-1620832771.pdf | 2021-05-17 19:06 | 138M | |
| Nursing.pdf | 2022-12-04 05:27 | 11M | |
| Nursing Care Plans, Edition 9 - Murr, Alice, Doenges, Marilynn, Moorehouse, Mary.pdf | 2022-12-04 05:27 | 7.7M | |
| Nursing Care at the End of Life What Every Clinician Should Know Susan E. Lowey.pdf | 2021-03-11 23:53 | 786K | |
| Nursing Diagnoses 2015-17 (1).pdf | 2022-12-04 05:27 | 1.9M | |
| Nursing Diagnoses 2015-2017 - Definitions and Classification, 10th Edition (Nanda Internation.pdf | 2022-12-04 05:27 | 2.6M | |
| Nursing Diagnoses in Psychiatric Nursing (3).pdf | 2022-12-04 05:27 | 11M | |
| Nursing Diagnoses in Psychiatric Nursing ( PDFDrive.com ).pdf | 2022-12-04 05:27 | 11M | |
| Nursing Diagnosis Pockets Guide.[Taylor, Cynthia.M.].pdf.pdf | 2022-12-04 05:27 | 2.5M | |
| Nursing Documentation_Mar10.pdf | 2022-12-04 05:27 | 1.6M | |
| Nursing Fundamentals DeMYSTiFieD A Self-Teaching Guide.pdf | 2022-12-04 05:27 | 3.0M | |
| Nursing Knowledge.pdf | 2022-12-04 05:27 | 1.3M | |
| Nursing Memory Joggers.pdf | 2022-12-04 05:27 | 64K | |
| Nursing Theories & Nursing Practice.pdf | 2022-12-04 05:27 | 8.5M | |
| Nursing Theories and Nursing Practice (2ed).pdf | 2022-12-04 05:27 | 3.9M | |
| Nursing Theories and Practice - Smith, Marlaine C. [SRG].pdf | 2022-12-04 05:27 | 5.0M | |
| Nursing diagnosis application to clinical practice [ Lynda, Juall].pdf | 2022-12-04 05:27 | 8.0M | |
| Nursing in Todays World.pdf | 2022-12-04 05:27 | 4.5M | |
| Nursing law and ethic [John, Tingle].pdf.pdf | 2022-12-04 05:27 | 2.4M | |
| Nursing leadershp final.pdf | 2022-12-04 05:27 | 540K | |
| Nursing malpractice.[ Charles C, Sharpe].pdf | 2022-12-04 05:27 | 11M | |
| Nursing practice in multiple sclerosis - a core curriculum.pdf | 2022-12-04 05:27 | 1.1M | |
| Nursing student medication errors.. a retrospective review.pdf | 2022-12-04 05:27 | 82K | |
| Nursing students. Tasks and routines in 21st century nursing.. student nurses' perceptions.pdf | 2022-12-04 05:27 | 538K | |
| Nursing theories and Nursing practice[4th ed] by Smith, Marlaine C.pdf | 2022-12-04 05:27 | 5.5M | |
| Nursing your baby 4th ed [Karen Pryor, Gale Pryor].pdf | 2022-12-04 05:27 | 2.9M | |
| Nutrition; A Handbook for Nurses [ Carolyn, Best].pdf | 2022-12-04 05:27 | 1.0M | |
| Nvqs for dental nurses. [Hollins, Carole].pdf | 2022-12-04 05:27 | 1.3M | |
| ORAL HEALTH CARE.pdf | 2022-12-04 05:27 | 331K | |
| Oncology nursing management in cancer care.pdf | 2022-12-04 05:27 | 663K | |
| Ophthalmic nursing 3rd edition [ Rosalind, Stollery].pdf | 2022-12-04 05:27 | 1.7M | |
| Outreach Mobile Health Services.pdf | 2022-12-04 05:27 | 879K | |
| Oxford handbook of reproductive medicine and family planning.pdf | 2022-12-04 05:27 | 2.5M | |
| PRIMARY EAR, NOSE AND THROAT CARE.pdf | 2022-12-04 05:27 | 1.3M | |
| PRIMARY EYE CARE.pdf | 2022-12-04 05:27 | 653K | |
| Pediatric Oncology Nursing- Advanced Clinical Handbook, 2nd Edition - Deborah Tomlinson & Nancy E. Kline.pdf | 2022-12-04 05:27 | 7.2M | |
| Pediatric Psychopharmacology for Primary Care 2nd Edition (2).Pdf | 2022-12-04 05:27 | 7.3M | |
| Pediatrics.pdf | 2022-12-04 05:27 | 498K | |
| Perceptions of nursing student clinical placement experiences.pdf | 2022-12-04 05:27 | 117K | |
| Perinatal Psychopharmacology 1st Edition.Pdf | 2022-12-04 05:27 | 4.4M | |
| Pharmacodynamics II, QuantitativeAspects of Drugs.pdf.pdf | 2022-12-04 05:27 | 2.2M | |
| Pharmacokinetics 1 by Dr. M, Mothilal.pdf.pdf | 2022-12-04 05:27 | 430K | |
| Pharmacological aspects of nursingcare [ Barry S, Reiss].pdf | 2022-12-04 05:27 | 15M | |
| Pharmacology 5th ed by Rosenfeld, Gary C.pdf | 2022-12-04 05:27 | 3.6M | |
| Pharmacology 10th ed.,[Stern, Arnald.]pf.pdf | 2022-12-04 05:27 | 2.3M | |
| Pharmacology and Toxicology of Amphetamine and Related Designer Drugs .[Asghar, Khursheed.]pdf.pdf | 2022-12-04 05:27 | 3.4M | |
| Pharmacology connections to nursing practice 3rd (1).pdf | 2022-12-04 05:27 | 36M | |
| Pharmacology for Dentistry.[Singh, Surender].pdf.pdf | 2022-12-04 05:27 | 5.0M | |
| Pharmacology for Nurses- A Pathophysiological Approach 2nd Edition.Pdf | 2022-12-04 05:27 | 44M | |
| Pharmacology in Rehabilitation 4th ed.pdf.pdf | 2022-12-04 05:27 | 14M | |
| Pharmacology of Neurotransmitter Release..pdf.pdf | 2022-12-04 05:27 | 5.0M | |
| Pocket Guide to Musculoskeletal Diagnosis.[Cooper, Grant.]pdf.pdf | 2022-12-04 05:27 | 3.3M | |
| Polyploidization and cancer advances in experiment Volume 668.pdf | 2022-12-04 05:27 | 3.4M | |
| Postoperative nursing management.pdf | 2022-12-04 05:27 | 497K | |
| Primary Health Nursing.pdf | 2022-12-04 05:27 | 882K | |
| Principles_of_Neuropsychology2.pdf | 2022-12-04 05:27 | 16M | |
| Professional issues in primary care nursing [Carol, Lynn].pdf | 2022-12-04 05:27 | 1.2M | |
| Psychosocial Issues in Pilliative Care .[Williams, Mari Lloyd].pdf | 2022-12-04 05:27 | 1.7M | |
| Psychosocial Nursing for general patient care. 3rd ed.[ Gorman, Linda M.].pdf | 2022-12-04 05:27 | 2.4M | |
| Psychosocial counselling and social work with clients and their families in the somali context.pdf | 2022-12-04 05:27 | 2.0M | |
| Public Health Nursing - Thornbory, Greta [SRG](3).pdf | 2022-12-04 05:27 | 2.4M | |
| Public Health Nursing - Thornbory, Greta [SRG].pdf | 2022-12-04 05:27 | 2.4M | |
| Public Health in Pharmacy Practice.pdf | 2021-03-11 23:53 | 19M | |
| Public Health in Pharmacy Practice by Jordan R Covvey.pdf | 2021-03-11 23:59 | 805K | |
| Public health interventions.pdf | 2022-12-04 05:27 | 1.2M | |
| Question answers microbiology-immunology- pdf.pdf | 2022-12-04 05:27 | 3.8M | |
| QuickStudy Nursing.pdf | 2022-12-04 05:27 | 1.7M | |
| QuickStudy_Nursing.pdf | 2022-12-04 05:27 | 1.7M | |
| RN Adult Medical Surgical Nursing 9th ed.pdf.pdf | 2022-12-04 05:27 | 5.5M | |
| Rehospitalizations among Patients pdf.pdf | 2022-12-04 05:27 | 620K | |
| Review_of_Atlas_of_Human_Anatomy_4Edition_by_Frank.pdf | 2022-12-04 05:27 | 252K | |
| Saunders Nursing Drug Handbook 2016 (2015).pdf | 2022-12-04 05:27 | 13M | |
| School Health Programme.pdf | 2022-12-04 05:27 | 945K | |
| Sociology aand Nursing.pdf | 2022-12-04 05:27 | 1.1M | |
| Sparks and taylors nursing diagnosis reference manual, 8th ed [Sheila, Sparks].pdf | 2022-12-04 05:27 | 6.3M | |
| Study Guide for Maternal Child Nursing Care - Perry, Shannon E. [SRG].pdf | 2022-12-04 05:27 | 65M | |
| Supportive Care for the Renal patient.[Chambers, joanna.E]].pdf | 2022-12-04 05:27 | 1.6M | |
| Surgical Treatment of Parkinson's Desease and Other Movement Disorders.[Tarsy,Daniel].pdf.pdf | 2022-12-04 05:27 | 5.7M | |
| Technology and Nursing informatics.pdf | 2022-12-04 05:27 | 1.3M | |
| Terre_des_Hommes-Working_with_Children_and_Their_Enviroment_Manual_of_Psycho-social_skills.pdf | 2022-12-04 05:27 | 22M | |
| Text book for community nursing.pdf | 2022-12-04 05:27 | 1.1M | |
| Textbook of hemophilia second-edition.pdf.pdf | 2022-12-04 05:27 | 5.7M | |
| The Biopsychosocial Model of Health and Disease by New Philosophical and Scientific Developments Derek, Bolton..pdf | 2021-05-19 10:14 | 1.8M | |
| The Diabetes in Pregnancy Dilemma 2nd Edition (1).Pdf | 2022-12-04 05:27 | 20M | |
| The Human Body ,Glocks and Nutrition ,Tell Agin ! Read - Aloud Supplental Guide.pdf.pdf | 2022-12-04 05:27 | 2.9M | |
| The Informed Practice Nurse 2nd ed [ Marilyn, Edwards].pdf | 2022-12-04 05:27 | 1.5M | |
| The Person with HIVAIDS, Third Edition, Nursing Perspectives,Jerry D. Durham,PhD, RN,FAAN.pdf | 2022-12-04 05:27 | 54M | |
| The effect of problem-based learning on nursing students' perceptions of empowerment.pdf | 2022-12-04 05:27 | 238K | |
| The meaning of empowerment for nursing students.. a critical incident study.pdf | 2022-12-04 05:27 | 112K | |
| Thinking Nursing [Mason, Tom].pdf.pdf | 2022-12-04 05:27 | 2.3M | |
| Transforming Nursing Through Reflective Practice.pdf | 2022-12-04 05:27 | 1.5M | |
| TransfusionMedicineHandbook.pdf | 2022-12-04 05:27 | 1.7M | |
| Transitions-to-professional-nursing 2nd Edition by Jamie Murphy.pdf | 2021-03-11 23:59 | 7.5M | |
| Tropical and Parasitic Infections in the Intensive Care Unit (Perspectives on Critical Care Infectious Diseases) ( PDFDrive ).pdf | 2022-12-04 05:27 | 3.8M | |
| Tuberculosis in Adults and Children by Dorothee, Heemskerk..pdf | 2021-05-19 09:03 | 1.8M | |
| UNIT I General Pharmacology.pdf.pdf | 2022-12-04 05:27 | 1.7M | |
| Understanding Immunology (2006) 0131968459 book.pdf | 2022-12-04 05:27 | 16M | |
| Understanding Research for Nursing Students. [ Peter, Ellis].pdf | 2022-12-04 05:27 | 762K | |
| Usaid Pakistan Maternal New born and child health program final eveluation.pdf | 2022-12-04 05:27 | 960K | |
| Veterinary Psychopharmacology 2nd ed.[Crowell, Sharon.L.]pdf.Pdf | 2022-12-04 05:27 | 2.9M | |
| WBC,RBC,Plt normal,abnormal and inclusions.pdf | 2022-12-04 05:27 | 1.2M | |
| Women's Health.pdf.pdf | 2022-12-04 05:27 | 4.7M | |
| [Drew Provan, Charles R. J. Singer, Trevor Baglin,(BookFi) heamatology.pdf | 2022-12-04 05:27 | 6.4M | |
| [Drew Provan]_ ABC of Clinical Haematology, 3rd edi(BookFi).pdf | 2022-12-04 05:27 | 2.7M | |
| [Pauline_McCabe]_Complementary_Therapies_in_Nursin(BookFi).pdf | 2022-12-04 05:27 | 2.7M | |
| [Stephen H.Gillespie (Editor)__Richard D. Pearson(BookFi) parasitology.pdf | 2022-12-04 05:27 | 12M | |
| [WendyLArnesonJeanBrickel]_ Clinical Chemistry A(BookFi).pdf | 2022-12-04 05:27 | 17M | |
| [Wilson G.N., Schroeder B.,Woo J.]_Biochemistry a(BookFi).pdf | 2022-12-04 05:27 | 3.1M | |
| ln hew nutrition final (2).pdf | 2022-12-04 05:27 | 239K | |
| ln pubilc health Nursing final.pdf | 2022-12-04 05:27 | 328K | |
| managerial-skill-development.pdf | 2022-12-04 05:27 | 1.3M | |
| mcqs in microbiology.pdf | 2022-12-04 05:27 | 433K | |
| nursing informatics.pdf | 2022-12-04 05:27 | 4.7M | |
| safeguarding reproductive health.pdf | 2022-12-04 05:27 | 2.7M | |
| students research projects.pdf | 2022-12-04 05:27 | 2.7M | |
|
|---|